C16H22O2 — CID 102591373
2-[(E)-3-methyl-5-phenylpent-3-enyl]-1,3-dioxane (PubChem CID 102591373) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-[(E)-3-methyl-5-phenylpent-3-enyl]-1,3-dioxane.
| Compound Name | 2-[(E)-3-methyl-5-phenylpent-3-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 102591373 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-[(E)-3-methyl-5-phenylpent-3-enyl]-1,3-dioxane |
| SMILES | C/C(=C\Cc1ccccc1)CCC1OCCCO1 |
| InChI | InChI=1S/C16H22O2/c1-14(8-10-15-6-3-2-4-7-15)9-11-16-17-12-5-13-18-16/h2-4,6-8,16H,5,9-13H2,1H3/b14-8+ |
| InChIKey | FCYARCSXITXNQN-RIYZIHGNSA-N |
| XLogP | 3.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|