About acetylene;(4S)-4-hydroxy-6-(hydroxymethyl)oxan-2-one;hydrate
acetylene;(4S)-4-hydroxy-6-(hydroxymethyl)oxan-2-one;hydrate (PubChem CID 143206459) has the molecular formula C10H16O5
and a molecular weight of 216.23 g/mol. Its IUPAC name is acetylene;(4S)-4-hydroxy-6-(hydroxymethyl)oxan-2-one;hydrate.
Molecular Properties
| Compound Name | acetylene;(4S)-4-hydroxy-6-(hydroxymethyl)oxan-2-one;hydrate |
| PubChem CID | 143206459 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | acetylene;(4S)-4-hydroxy-6-(hydroxymethyl)oxan-2-one;hydrate |
| SMILES | C#C.C#C.O.O=C1C[C@@H](O)CC(CO)O1 |
| InChI | InChI=1S/C6H10O4.2C2H2.H2O/c7-3-5-1-4(8)2-6(9)10-5;2*1-2;/h4-5,7-8H,1-3H2;2*1-2H;1H2/t4-,5?;;;/m0.../s1 |
| InChIKey | RRVVWOXEHXFUQU-PQRVQRBZSA-N |
| XLogP | -1.28 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;(4S)-4-hydroxy-6-(hydroxymethyl)oxan-2-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;(4S)-4-hydroxy-6-(hydroxymethyl)oxan-2-one;hydrate?
The IUPAC name of acetylene;(4S)-4-hydroxy-6-(hydroxymethyl)oxan-2-one;hydrate (CID 143206459) is acetylene;(4S)-4-hydroxy-6-(hydroxymethyl)oxan-2-one;hydrate.
What is the SMILES notation for acetylene;(4S)-4-hydroxy-6-(hydroxymethyl)oxan-2-one;hydrate?
The canonical SMILES for acetylene;(4S)-4-hydroxy-6-(hydroxymethyl)oxan-2-one;hydrate is C#C.C#C.O.O=C1C[C@@H](O)CC(CO)O1.
What is the InChIKey of acetylene;(4S)-4-hydroxy-6-(hydroxymethyl)oxan-2-one;hydrate?
The InChIKey is RRVVWOXEHXFUQU-PQRVQRBZSA-N. The full InChI is InChI=1S/C6H10O4.2C2H2.H2O/c7-3-5-1-4(8)2-6(9)10-5;2*1-2;/h4-5,7-8H,1-3H2;2*1-2H;1H2/t4-,5?;;;/m0.../s1.
What are the key properties of acetylene;(4S)-4-hydroxy-6-(hydroxymethyl)oxan-2-one;hydrate?
acetylene;(4S)-4-hydroxy-6-(hydroxymethyl)oxan-2-one;hydrate has a molecular weight of 216.23 g/mol, XLogP of -1.28, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;(4S)-4-hydroxy-6-(hydroxymethyl)oxan-2-one;hydrate is sourced from PubChem (CID 143206459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).