C8H14O3 — CID 143055068
ethane;5-ethyloxolane-2,4-dione (PubChem CID 143055068) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is ethane;5-ethyloxolane-2,4-dione.
| Compound Name | ethane;5-ethyloxolane-2,4-dione |
|---|---|
| PubChem CID | 143055068 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | ethane;5-ethyloxolane-2,4-dione |
| SMILES | CC.CCC1OC(=O)CC1=O |
| InChI | InChI=1S/C6H8O3.C2H6/c1-2-5-4(7)3-6(8)9-5;1-2/h5H,2-3H2,1H3;1-2H3 |
| InChIKey | ISTARYLCAHUUKL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|