About ethane;5-ethyloxolane-2,4-dione
ethane;5-ethyloxolane-2,4-dione (PubChem CID 143055068) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is ethane;5-ethyloxolane-2,4-dione.
Molecular Properties
| Compound Name | ethane;5-ethyloxolane-2,4-dione |
| PubChem CID | 143055068 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | ethane;5-ethyloxolane-2,4-dione |
| SMILES | CC.CCC1OC(=O)CC1=O |
| InChI | InChI=1S/C6H8O3.C2H6/c1-2-5-4(7)3-6(8)9-5;1-2/h5H,2-3H2,1H3;1-2H3 |
| InChIKey | ISTARYLCAHUUKL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-ethyloxolane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethyloxolane-2,4-dione?
The IUPAC name of ethane;5-ethyloxolane-2,4-dione (CID 143055068) is ethane;5-ethyloxolane-2,4-dione.
What is the SMILES notation for ethane;5-ethyloxolane-2,4-dione?
The canonical SMILES for ethane;5-ethyloxolane-2,4-dione is CC.CCC1OC(=O)CC1=O.
What is the InChIKey of ethane;5-ethyloxolane-2,4-dione?
The InChIKey is ISTARYLCAHUUKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3.C2H6/c1-2-5-4(7)3-6(8)9-5;1-2/h5H,2-3H2,1H3;1-2H3.
What are the key properties of ethane;5-ethyloxolane-2,4-dione?
ethane;5-ethyloxolane-2,4-dione has a molecular weight of 158.20 g/mol, XLogP of 1.31, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethyloxolane-2,4-dione is sourced from PubChem (CID 143055068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).