C6H10O5 — CID 119097386
(4R,6R)-4,6-bis(hydroxymethyl)-1,3-dioxan-5-one (PubChem CID 119097386) has the molecular formula C6H10O5 and a molecular weight of 162.14 g/mol. Its IUPAC name is (4R,6R)-4,6-bis(hydroxymethyl)-1,3-dioxan-5-one.
| Compound Name | (4R,6R)-4,6-bis(hydroxymethyl)-1,3-dioxan-5-one |
|---|---|
| PubChem CID | 119097386 |
| Molecular Formula | C6H10O5 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | (4R,6R)-4,6-bis(hydroxymethyl)-1,3-dioxan-5-one |
| SMILES | O=C1[C@@H](CO)OCO[C@@H]1CO |
| InChI | InChI=1S/C6H10O5/c7-1-4-6(9)5(2-8)11-3-10-4/h4-5,7-8H,1-3H2/t4-,5-/m1/s1 |
| InChIKey | HNHHIQANJMMJDT-RFZPGFLSSA-N |
| XLogP | -1.72 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |