C6H10O6 — CID 175884762
(2R,4R,5S,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-one (PubChem CID 175884762) has the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. Its IUPAC name is (2R,4R,5S,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-one.
| Compound Name | (2R,4R,5S,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-one |
|---|---|
| PubChem CID | 175884762 |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | (2R,4R,5S,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-one |
| SMILES | O=C1[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H10O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2,4-7,9-11H,1H2/t2-,4+,5+,6+/m1/s1 |
| InChIKey | XUXWOYRIGVQFMU-JSTMLOLSSA-N |
| XLogP | -3.01 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |