C5H8O4 — CID 130965097
(4R,5R)-5-(hydroxymethyl)-1,3-dioxolane-4-carbaldehyde (PubChem CID 130965097) has the molecular formula C5H8O4 and a molecular weight of 132.12 g/mol. Its IUPAC name is (4R,5R)-5-(hydroxymethyl)-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4R,5R)-5-(hydroxymethyl)-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 130965097 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | (4R,5R)-5-(hydroxymethyl)-1,3-dioxolane-4-carbaldehyde |
| SMILES | O=C[C@@H]1OCO[C@@H]1CO |
| InChI | InChI=1S/C5H8O4/c6-1-4-5(2-7)9-3-8-4/h1,4-5,7H,2-3H2/t4-,5+/m0/s1 |
| InChIKey | BQJXAPUKOXECKB-CRCLSJGQSA-N |
| XLogP | -1.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|