About 8,8-dimethyl-3,4,4a,5,6,7-hexahydronaphthalen-2-one
8,8-dimethyl-3,4,4a,5,6,7-hexahydronaphthalen-2-one (PubChem CID 14712623) has the molecular formula C12H18O
and a molecular weight of 178.28 g/mol. Its IUPAC name is 8,8-dimethyl-3,4,4a,5,6,7-hexahydronaphthalen-2-one.
Analyze 8,8-dimethyl-3,4,4a,5,6,7-hexahydronaphthalen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-dimethyl-3,4,4a,5,6,7-hexahydronaphthalen-2-one?
The IUPAC name of 8,8-dimethyl-3,4,4a,5,6,7-hexahydronaphthalen-2-one (CID 14712623) is 8,8-dimethyl-3,4,4a,5,6,7-hexahydronaphthalen-2-one.
What is the SMILES notation for 8,8-dimethyl-3,4,4a,5,6,7-hexahydronaphthalen-2-one?
The canonical SMILES for 8,8-dimethyl-3,4,4a,5,6,7-hexahydronaphthalen-2-one is CC1(C)CCCC2CCC(=O)C=C21.
What is the InChIKey of 8,8-dimethyl-3,4,4a,5,6,7-hexahydronaphthalen-2-one?
The InChIKey is OESWKDVUINOYNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c1-12(2)7-3-4-9-5-6-10(13)8-11(9)12/h8-9H,3-7H2,1-2H3.
What are the key properties of 8,8-dimethyl-3,4,4a,5,6,7-hexahydronaphthalen-2-one?
8,8-dimethyl-3,4,4a,5,6,7-hexahydronaphthalen-2-one has a molecular weight of 178.28 g/mol, XLogP of 3.10, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-dimethyl-3,4,4a,5,6,7-hexahydronaphthalen-2-one is sourced from PubChem (CID 14712623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).