C16H22O — CID 11528741
(4bS)-4b,8,8-trimethyl-3,4,4a,5,6,7-hexahydrofluoren-2-one (PubChem CID 11528741) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (4bS)-4b,8,8-trimethyl-3,4,4a,5,6,7-hexahydrofluoren-2-one.
| Compound Name | (4bS)-4b,8,8-trimethyl-3,4,4a,5,6,7-hexahydrofluoren-2-one |
|---|---|
| PubChem CID | 11528741 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (4bS)-4b,8,8-trimethyl-3,4,4a,5,6,7-hexahydrofluoren-2-one |
| SMILES | CC1(C)CCC[C@]2(C)C1=CC1=CC(=O)CCC12 |
| InChI | InChI=1S/C16H22O/c1-15(2)7-4-8-16(3)13-6-5-12(17)9-11(13)10-14(15)16/h9-10,13H,4-8H2,1-3H3/t13?,16-/m0/s1 |
| InChIKey | IEOHHNPYBKIEMP-VYIIXAMBSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |