C17H24O2 — CID 163114690
(4aR,4bR,8R,8aR)-8-(hydroxymethyl)-4b,8-dimethyl-4,4a,5,6,7,8a-hexahydro-3H-phenanthren-2-one (PubChem CID 163114690) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (4aR,4bR,8R,8aR)-8-(hydroxymethyl)-4b,8-dimethyl-4,4a,5,6,7,8a-hexahydro-3H-phenanthren-2-one.
| Compound Name | (4aR,4bR,8R,8aR)-8-(hydroxymethyl)-4b,8-dimethyl-4,4a,5,6,7,8a-hexahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 163114690 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (4aR,4bR,8R,8aR)-8-(hydroxymethyl)-4b,8-dimethyl-4,4a,5,6,7,8a-hexahydro-3H-phenanthren-2-one |
| SMILES | C[C@@]1(CO)CCC[C@]2(C)[C@H]3CCC(=O)C=C3C=C[C@@H]12 |
| InChI | InChI=1S/C17H24O2/c1-16(11-18)8-3-9-17(2)14-6-5-13(19)10-12(14)4-7-15(16)17/h4,7,10,14-15,18H,3,5-6,8-9,11H2,1-2H3/t14-,15-,16-,17+/m0/s1 |
| InChIKey | VZTUEQDIHMRLMG-LUKYLMHMSA-N |
| XLogP | 3.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |