C12H18O — CID 18320201
3-cyclobutyl-4,4-dimethylcyclohex-2-en-1-one (PubChem CID 18320201) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 3-cyclobutyl-4,4-dimethylcyclohex-2-en-1-one.
| Compound Name | 3-cyclobutyl-4,4-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 18320201 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 3-cyclobutyl-4,4-dimethylcyclohex-2-en-1-one |
| SMILES | CC1(C)CCC(=O)C=C1C1CCC1 |
| InChI | InChI=1S/C12H18O/c1-12(2)7-6-10(13)8-11(12)9-4-3-5-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | NMZLUSGOPNBXIX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |