C13H18O4 — CID 15624595
(4'aR,8'R)-8'-hydroxy-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one (PubChem CID 15624595) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (4'aR,8'R)-8'-hydroxy-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one.
| Compound Name | (4'aR,8'R)-8'-hydroxy-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one |
|---|---|
| PubChem CID | 15624595 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (4'aR,8'R)-8'-hydroxy-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one |
| SMILES | C[C@@]12CCC(=O)C=C1[C@H](O)CCC21OCCO1 |
| InChI | InChI=1S/C13H18O4/c1-12-4-2-9(14)8-10(12)11(15)3-5-13(12)16-6-7-17-13/h8,11,15H,2-7H2,1H3/t11-,12-/m1/s1 |
| InChIKey | YCDAPILVLPDEHG-VXGBXAGGSA-N |
| XLogP | 1.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |