C16H24O5 — CID 102009736
methyl (1'R,2'S,4'aS)-2'-hydroxy-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7-tetrahydro-2H-naphthalene]-1'-carboxylate (PubChem CID 102009736) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is methyl (1'R,2'S,4'aS)-2'-hydroxy-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7-tetrahydro-2H-naphthalene]-1'-carboxylate.
| Compound Name | methyl (1'R,2'S,4'aS)-2'-hydroxy-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7-tetrahydro-2H-naphthalene]-1'-carboxylate |
|---|---|
| PubChem CID | 102009736 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | methyl (1'R,2'S,4'aS)-2'-hydroxy-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7-tetrahydro-2H-naphthalene]-1'-carboxylate |
| SMILES | COC(=O)[C@]1(C)C2=CCCC3(OCCO3)[C@@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C16H24O5/c1-14-8-6-12(17)15(2,13(18)19-3)11(14)5-4-7-16(14)20-9-10-21-16/h5,12,17H,4,6-10H2,1-3H3/t12-,14-,15+/m0/s1 |
| InChIKey | ABFNSHTZFKFPQL-AEGPPILISA-N |
| XLogP | 1.79 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|