About 3-hydroxy-4,4-dimethylcyclohex-2-en-1-one
3-hydroxy-4,4-dimethylcyclohex-2-en-1-one (PubChem CID 13297859) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 3-hydroxy-4,4-dimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-hydroxy-4,4-dimethylcyclohex-2-en-1-one |
| PubChem CID | 13297859 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 3-hydroxy-4,4-dimethylcyclohex-2-en-1-one |
| SMILES | CC1(C)CCC(=O)C=C1O |
| InChI | InChI=1S/C8H12O2/c1-8(2)4-3-6(9)5-7(8)10/h5,10H,3-4H2,1-2H3 |
| InChIKey | ACLOTXWRIQLMEM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxy-4,4-dimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-4,4-dimethylcyclohex-2-en-1-one?
The IUPAC name of 3-hydroxy-4,4-dimethylcyclohex-2-en-1-one (CID 13297859) is 3-hydroxy-4,4-dimethylcyclohex-2-en-1-one.
What is the SMILES notation for 3-hydroxy-4,4-dimethylcyclohex-2-en-1-one?
The canonical SMILES for 3-hydroxy-4,4-dimethylcyclohex-2-en-1-one is CC1(C)CCC(=O)C=C1O.
What is the InChIKey of 3-hydroxy-4,4-dimethylcyclohex-2-en-1-one?
The InChIKey is ACLOTXWRIQLMEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-8(2)4-3-6(9)5-7(8)10/h5,10H,3-4H2,1-2H3.
What are the key properties of 3-hydroxy-4,4-dimethylcyclohex-2-en-1-one?
3-hydroxy-4,4-dimethylcyclohex-2-en-1-one has a molecular weight of 140.18 g/mol, XLogP of 1.82, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-4,4-dimethylcyclohex-2-en-1-one is sourced from PubChem (CID 13297859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).