C8H10O3 — CID 163124391
5-hydroxy-6,6-dimethylcyclohex-4-ene-1,3-dione (PubChem CID 163124391) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is 5-hydroxy-6,6-dimethylcyclohex-4-ene-1,3-dione.
| Compound Name | 5-hydroxy-6,6-dimethylcyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 163124391 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 5-hydroxy-6,6-dimethylcyclohex-4-ene-1,3-dione |
| SMILES | CC1(C)C(=O)CC(=O)C=C1O |
| InChI | InChI=1S/C8H10O3/c1-8(2)6(10)3-5(9)4-7(8)11/h3,10H,4H2,1-2H3 |
| InChIKey | CHFCNWCEHGDVKI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|