C17H24O3 — CID 24749109
5-methoxy-6,6-bis(3-methylbut-2-enyl)cyclohex-4-ene-1,3-dione (PubChem CID 24749109) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 5-methoxy-6,6-bis(3-methylbut-2-enyl)cyclohex-4-ene-1,3-dione.
| Compound Name | 5-methoxy-6,6-bis(3-methylbut-2-enyl)cyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 24749109 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 5-methoxy-6,6-bis(3-methylbut-2-enyl)cyclohex-4-ene-1,3-dione |
| SMILES | COC1=CC(=O)CC(=O)C1(CC=C(C)C)CC=C(C)C |
| InChI | InChI=1S/C17H24O3/c1-12(2)6-8-17(9-7-13(3)4)15(19)10-14(18)11-16(17)20-5/h6-7,11H,8-10H2,1-5H3 |
| InChIKey | LEFAQQGYGUBVCH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|