C27H40O3 — CID 16681574
(1R,5S,7R)-4-methoxy-8,8-dimethyl-1,5,7-tris(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 16681574) has the molecular formula C27H40O3 and a molecular weight of 412.61 g/mol. Its IUPAC name is (1R,5S,7R)-4-methoxy-8,8-dimethyl-1,5,7-tris(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (1R,5S,7R)-4-methoxy-8,8-dimethyl-1,5,7-tris(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 16681574 |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | (1R,5S,7R)-4-methoxy-8,8-dimethyl-1,5,7-tris(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | COC1=CC(=O)[C@]2(CC=C(C)C)C(=O)[C@@]1(CC=C(C)C)C[C@@H](CC=C(C)C)C2(C)C |
| InChI | InChI=1S/C27H40O3/c1-18(2)10-11-21-17-26(14-12-19(3)4)23(30-9)16-22(28)27(24(26)29,25(21,7)8)15-13-20(5)6/h10,12-13,16,21H,11,14-15,17H2,1-9H3/t21-,26+,27-/m1/s1 |
| InChIKey | VCZRQEIGMNXSNJ-COFKYPDJSA-N |
| XLogP | 6.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|