C27H38O3 — CID 16732799
(1S,5S,7S)-4-methoxy-6,6-dimethyl-3-[(1E)-3-methylbuta-1,3-dienyl]-1,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 16732799) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is (1S,5S,7S)-4-methoxy-6,6-dimethyl-3-[(1E)-3-methylbuta-1,3-dienyl]-1,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (1S,5S,7S)-4-methoxy-6,6-dimethyl-3-[(1E)-3-methylbuta-1,3-dienyl]-1,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 16732799 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | (1S,5S,7S)-4-methoxy-6,6-dimethyl-3-[(1E)-3-methylbuta-1,3-dienyl]-1,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | C=C(C)/C=C/C1=C(OC)[C@H]2C(=O)[C@](CC=C(C)C)(C[C@H](CC=C(C)C)C2(C)C)C1=O |
| InChI | InChI=1S/C27H38O3/c1-17(2)10-12-20-16-27(15-14-19(5)6)24(28)21(13-11-18(3)4)23(30-9)22(25(27)29)26(20,7)8/h10-11,13-14,20,22H,3,12,15-16H2,1-2,4-9H3/b13-11+/t20-,22-,27+/m0/s1 |
| InChIKey | XAAGEWIJLZZHLV-OQGIHXDQSA-N |
| XLogP | 6.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|