C26H42O3 — CID 23729548
3-[(1R,3R,5S)-4,4-dimethyl-1,3,5-tris(3-methylbut-2-enyl)-2-oxocyclohexyl]propanoic acid (PubChem CID 23729548) has the molecular formula C26H42O3 and a molecular weight of 402.62 g/mol. Its IUPAC name is 3-[(1R,3R,5S)-4,4-dimethyl-1,3,5-tris(3-methylbut-2-enyl)-2-oxocyclohexyl]propanoic acid.
| Compound Name | 3-[(1R,3R,5S)-4,4-dimethyl-1,3,5-tris(3-methylbut-2-enyl)-2-oxocyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 23729548 |
| Molecular Formula | C26H42O3 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | 3-[(1R,3R,5S)-4,4-dimethyl-1,3,5-tris(3-methylbut-2-enyl)-2-oxocyclohexyl]propanoic acid |
| SMILES | CC(C)=CC[C@H]1C[C@](CC=C(C)C)(CCC(=O)O)C(=O)[C@H](CC=C(C)C)C1(C)C |
| InChI | InChI=1S/C26H42O3/c1-18(2)9-11-21-17-26(15-13-20(5)6,16-14-23(27)28)24(29)22(25(21,7)8)12-10-19(3)4/h9-10,13,21-22H,11-12,14-17H2,1-8H3,(H,27,28)/t21-,22-,26-/m0/s1 |
| InChIKey | SGUJYQKATLHXNQ-MCEYFSPLSA-N |
| XLogP | 7.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|