C31H48O2 — CID 102298548
(1S,5R,7S,8R)-8-methyl-3,5,7-tris(3-methylbut-2-enyl)-8-(4-methylpent-3-enyl)bicyclo[3.3.1]nonane-2,9-dione (PubChem CID 102298548) has the molecular formula C31H48O2 and a molecular weight of 452.72 g/mol. Its IUPAC name is (1S,5R,7S,8R)-8-methyl-3,5,7-tris(3-methylbut-2-enyl)-8-(4-methylpent-3-enyl)bicyclo[3.3.1]nonane-2,9-dione.
| Compound Name | (1S,5R,7S,8R)-8-methyl-3,5,7-tris(3-methylbut-2-enyl)-8-(4-methylpent-3-enyl)bicyclo[3.3.1]nonane-2,9-dione |
|---|---|
| PubChem CID | 102298548 |
| Molecular Formula | C31H48O2 |
| Molecular Weight | 452.72 g/mol |
| Exact Mass | 452.37 |
| IUPAC Name | (1S,5R,7S,8R)-8-methyl-3,5,7-tris(3-methylbut-2-enyl)-8-(4-methylpent-3-enyl)bicyclo[3.3.1]nonane-2,9-dione |
| SMILES | CC(C)=CCC[C@]1(C)[C@@H](CC=C(C)C)C[C@]2(CC=C(C)C)CC(CC=C(C)C)C(=O)[C@H]1C2=O |
| InChI | InChI=1S/C31H48O2/c1-21(2)11-10-17-30(9)26(15-13-23(5)6)20-31(18-16-24(7)8)19-25(14-12-22(3)4)28(32)27(30)29(31)33/h11-13,16,25-27H,10,14-15,17-20H2,1-9H3/t25?,26-,27-,30+,31-/m0/s1 |
| InChIKey | QAQOWRNWVJHABP-SQPNTKTNSA-N |
| XLogP | 8.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.72 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|