C26H38O3 — CID 24809232
(1S,3R,4R,5R)-4-methyl-1,3-bis(3-methylbut-2-enyl)-4-(4-methylpent-3-enyl)bicyclo[3.3.1]nonane-2,6,9-trione (PubChem CID 24809232) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is (1S,3R,4R,5R)-4-methyl-1,3-bis(3-methylbut-2-enyl)-4-(4-methylpent-3-enyl)bicyclo[3.3.1]nonane-2,6,9-trione.
| Compound Name | (1S,3R,4R,5R)-4-methyl-1,3-bis(3-methylbut-2-enyl)-4-(4-methylpent-3-enyl)bicyclo[3.3.1]nonane-2,6,9-trione |
|---|---|
| PubChem CID | 24809232 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | (1S,3R,4R,5R)-4-methyl-1,3-bis(3-methylbut-2-enyl)-4-(4-methylpent-3-enyl)bicyclo[3.3.1]nonane-2,6,9-trione |
| SMILES | CC(C)=CCC[C@@]1(C)[C@@H]2C(=O)CC[C@@](CC=C(C)C)(C2=O)C(=O)[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C26H38O3/c1-17(2)9-8-14-25(7)20(11-10-18(3)4)23(28)26(15-12-19(5)6)16-13-21(27)22(25)24(26)29/h9-10,12,20,22H,8,11,13-16H2,1-7H3/t20-,22+,25+,26+/m0/s1 |
| InChIKey | GPYTXFODOHELGJ-STVNMGNLSA-N |
| XLogP | 6.19 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|