C28H44O4 — CID 101461629
ethyl 3-[(1R,3R,4S)-4-methyl-1,3-bis(3-methylbut-2-enyl)-4-(4-methylpent-3-enyl)-2,6-dioxocyclohexyl]propanoate (PubChem CID 101461629) has the molecular formula C28H44O4 and a molecular weight of 444.66 g/mol. Its IUPAC name is ethyl 3-[(1R,3R,4S)-4-methyl-1,3-bis(3-methylbut-2-enyl)-4-(4-methylpent-3-enyl)-2,6-dioxocyclohexyl]propanoate.
| Compound Name | ethyl 3-[(1R,3R,4S)-4-methyl-1,3-bis(3-methylbut-2-enyl)-4-(4-methylpent-3-enyl)-2,6-dioxocyclohexyl]propanoate |
|---|---|
| PubChem CID | 101461629 |
| Molecular Formula | C28H44O4 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | ethyl 3-[(1R,3R,4S)-4-methyl-1,3-bis(3-methylbut-2-enyl)-4-(4-methylpent-3-enyl)-2,6-dioxocyclohexyl]propanoate |
| SMILES | CCOC(=O)CC[C@@]1(CC=C(C)C)C(=O)C[C@](C)(CCC=C(C)C)[C@@H](CC=C(C)C)C1=O |
| InChI | InChI=1S/C28H44O4/c1-9-32-25(30)15-18-28(17-14-22(6)7)24(29)19-27(8,16-10-11-20(2)3)23(26(28)31)13-12-21(4)5/h11-12,14,23H,9-10,13,15-19H2,1-8H3/t23-,27-,28-/m0/s1 |
| InChIKey | JBWINKRJSKSLFU-RNCAPKPVSA-N |
| XLogP | 6.94 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|