C21H30O4 — CID 123623973
7-hydroxy-6-methyl-1-(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)bicyclo[3.3.1]nonane-2,4,9-trione (PubChem CID 123623973) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 7-hydroxy-6-methyl-1-(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)bicyclo[3.3.1]nonane-2,4,9-trione.
| Compound Name | 7-hydroxy-6-methyl-1-(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
|---|---|
| PubChem CID | 123623973 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 7-hydroxy-6-methyl-1-(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
| SMILES | CC(C)=CCCC1(C)C(O)CC2(CC=C(C)C)C(=O)CC(=O)C1C2=O |
| InChI | InChI=1S/C21H30O4/c1-13(2)7-6-9-20(5)17(24)12-21(10-8-14(3)4)16(23)11-15(22)18(20)19(21)25/h7-8,17-18,24H,6,9-12H2,1-5H3 |
| InChIKey | MIGOUSZVISAMFT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|