C36H54O3 — CID 171355596
(1S,5R,7R)-1,5-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-6,6-dimethyl-7-(3-methylbut-2-enyl)bicyclo[3.3.1]nonane-2,4,9-trione (PubChem CID 171355596) has the molecular formula C36H54O3 and a molecular weight of 534.83 g/mol. Its IUPAC name is (1S,5R,7R)-1,5-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-6,6-dimethyl-7-(3-methylbut-2-enyl)bicyclo[3.3.1]nonane-2,4,9-trione.
| Compound Name | (1S,5R,7R)-1,5-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-6,6-dimethyl-7-(3-methylbut-2-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
|---|---|
| PubChem CID | 171355596 |
| Molecular Formula | C36H54O3 |
| Molecular Weight | 534.83 g/mol |
| Exact Mass | 534.41 |
| IUPAC Name | (1S,5R,7R)-1,5-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-6,6-dimethyl-7-(3-methylbut-2-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
| SMILES | CC(C)=CCC/C(C)=C/C[C@]12C[C@@H](CC=C(C)C)C(C)(C)[C@](C/C=C(\C)CCC=C(C)C)(C(=O)CC1=O)C2=O |
| InChI | InChI=1S/C36H54O3/c1-25(2)13-11-15-28(7)19-21-35-24-30(18-17-27(5)6)34(9,10)36(33(35)39,32(38)23-31(35)37)22-20-29(8)16-12-14-26(3)4/h13-14,17,19-20,30H,11-12,15-16,18,21-24H2,1-10H3/b28-19+,29-20+/t30-,35+,36-/m1/s1 |
| InChIKey | FETVWCGPNXSJCN-RNKMNTNESA-N |
| XLogP | 9.64 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.83 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|