C35H44O4 — CID 162900629
(1R,5R,7S,9R,11S)-9-benzoyl-11-(3,7-dimethylocta-2,6-dienyl)-4,4,8,8-tetramethyltetracyclo[7.3.1.17,11.01,5]tetradecane-10,12,13-trione (PubChem CID 162900629) has the molecular formula C35H44O4 and a molecular weight of 528.73 g/mol. Its IUPAC name is (1R,5R,7S,9R,11S)-9-benzoyl-11-(3,7-dimethylocta-2,6-dienyl)-4,4,8,8-tetramethyltetracyclo[7.3.1.17,11.01,5]tetradecane-10,12,13-trione.
| Compound Name | (1R,5R,7S,9R,11S)-9-benzoyl-11-(3,7-dimethylocta-2,6-dienyl)-4,4,8,8-tetramethyltetracyclo[7.3.1.17,11.01,5]tetradecane-10,12,13-trione |
|---|---|
| PubChem CID | 162900629 |
| Molecular Formula | C35H44O4 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | (1R,5R,7S,9R,11S)-9-benzoyl-11-(3,7-dimethylocta-2,6-dienyl)-4,4,8,8-tetramethyltetracyclo[7.3.1.17,11.01,5]tetradecane-10,12,13-trione |
| SMILES | CC(C)=CCCC(C)=CC[C@]12C[C@@H]3C[C@@H]4C(C)(C)CC[C@@]4(C1=O)C(=O)[C@](C(=O)c1ccccc1)(C2=O)C3(C)C |
| InChI | InChI=1S/C35H44O4/c1-22(2)12-11-13-23(3)16-17-33-21-25-20-26-31(4,5)18-19-34(26,28(33)37)30(39)35(29(33)38,32(25,6)7)27(36)24-14-9-8-10-15-24/h8-10,12,14-16,25-26H,11,13,17-21H2,1-7H3/t25-,26+,33-,34+,35-/m0/s1 |
| InChIKey | GATAACFVMKVHPQ-TYYMSAKASA-N |
| XLogP | 7.52 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|