C43H58O6 — CID 3528
3-[(3,4-dihydroxyphenyl)-hydroxymethylidene]-1,7-bis(3,7-dimethylocta-2,6-dienyl)-6,6-dimethyl-5-(3-methylbut-2-enyl)bicyclo[3.3.1]nonane-2,4,9-trione (PubChem CID 3528) has the molecular formula C43H58O6 and a molecular weight of 670.93 g/mol. Its IUPAC name is 3-[(3,4-dihydroxyphenyl)-hydroxymethylidene]-1,7-bis(3,7-dimethylocta-2,6-dienyl)-6,6-dimethyl-5-(3-methylbut-2-enyl)bicyclo[3.3.1]nonane-2,4,9-trione.
| Compound Name | 3-[(3,4-dihydroxyphenyl)-hydroxymethylidene]-1,7-bis(3,7-dimethylocta-2,6-dienyl)-6,6-dimethyl-5-(3-methylbut-2-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
|---|---|
| PubChem CID | 3528 |
| Molecular Formula | C43H58O6 |
| Molecular Weight | 670.93 g/mol |
| Exact Mass | 670.42 |
| IUPAC Name | 3-[(3,4-dihydroxyphenyl)-hydroxymethylidene]-1,7-bis(3,7-dimethylocta-2,6-dienyl)-6,6-dimethyl-5-(3-methylbut-2-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
| SMILES | CC(C)=CCCC(C)=CCC1CC2(CC=C(C)CCC=C(C)C)C(=O)C(=C(O)c3ccc(O)c(O)c3)C(=O)C(CC=C(C)C)(C2=O)C1(C)C |
| InChI | InChI=1S/C43H58O6/c1-27(2)13-11-15-30(7)17-19-33-26-42(23-22-31(8)16-12-14-28(3)4)38(47)36(37(46)32-18-20-34(44)35(45)25-32)39(48)43(40(42)49,41(33,9)10)24-21-29(5)6/h13-14,17-18,20-22,25,33,44-46H,11-12,15-16,19,23-24,26H2,1-10H3 |
| InChIKey | AWADGPGGHLGLFD-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.93 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|