C39H52O6 — CID 163058714
3-[(3,4-dihydroxyphenyl)-hydroxymethylidene]-6,6-dimethyl-5,7-bis(3-methylbut-2-enyl)-1-(6-methyl-3-prop-1-en-2-ylhept-5-enyl)bicyclo[3.3.1]nonane-2,4,9-trione (PubChem CID 163058714) has the molecular formula C39H52O6 and a molecular weight of 616.84 g/mol. Its IUPAC name is 3-[(3,4-dihydroxyphenyl)-hydroxymethylidene]-6,6-dimethyl-5,7-bis(3-methylbut-2-enyl)-1-(6-methyl-3-prop-1-en-2-ylhept-5-enyl)bicyclo[3.3.1]nonane-2,4,9-trione.
| Compound Name | 3-[(3,4-dihydroxyphenyl)-hydroxymethylidene]-6,6-dimethyl-5,7-bis(3-methylbut-2-enyl)-1-(6-methyl-3-prop-1-en-2-ylhept-5-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
|---|---|
| PubChem CID | 163058714 |
| Molecular Formula | C39H52O6 |
| Molecular Weight | 616.84 g/mol |
| Exact Mass | 616.38 |
| IUPAC Name | 3-[(3,4-dihydroxyphenyl)-hydroxymethylidene]-6,6-dimethyl-5,7-bis(3-methylbut-2-enyl)-1-(6-methyl-3-prop-1-en-2-ylhept-5-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
| SMILES | C=C(C)C(CC=C(C)C)CCC12CC(CC=C(C)C)C(C)(C)C(CC=C(C)C)(C(=O)C(=C(O)c3ccc(O)c(O)c3)C1=O)C2=O |
| InChI | InChI=1S/C39H52O6/c1-23(2)11-13-27(26(7)8)18-19-38-22-29(15-12-24(3)4)37(9,10)39(36(38)45,20-17-25(5)6)35(44)32(34(38)43)33(42)28-14-16-30(40)31(41)21-28/h11-12,14,16-17,21,27,29,40-42H,7,13,15,18-20,22H2,1-6,8-10H3 |
| InChIKey | QZHFLFWIRDRAQL-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.84 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|