C18H30O — CID 73214634
3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexan-1-one (PubChem CID 73214634) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is 3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexan-1-one.
| Compound Name | 3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 73214634 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexan-1-one |
| SMILES | CC(C)=CCC1CCC(=O)C(CC=C(C)C)C1(C)C |
| InChI | InChI=1S/C18H30O/c1-13(2)7-9-15-10-12-17(19)16(18(15,5)6)11-8-14(3)4/h7-8,15-16H,9-12H2,1-6H3 |
| InChIKey | FTRRTQMCJPSBDG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|