C20H30O4 — CID 72734928
trans-methyl (1S,5R)-3-acetyl-4,4-dimethyl-1-(3-methylbut-2-enyl)-2-oxo-5-prop-2-enylcyclohexane-1-carboxylate (PubChem CID 72734928) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is trans-methyl (1S,5R)-3-acetyl-4,4-dimethyl-1-(3-methylbut-2-enyl)-2-oxo-5-prop-2-enylcyclohexane-1-carboxylate.
| Compound Name | trans-methyl (1S,5R)-3-acetyl-4,4-dimethyl-1-(3-methylbut-2-enyl)-2-oxo-5-prop-2-enylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 72734928 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | trans-methyl (1S,5R)-3-acetyl-4,4-dimethyl-1-(3-methylbut-2-enyl)-2-oxo-5-prop-2-enylcyclohexane-1-carboxylate |
| SMILES | C=CC[C@@H]1C[C@](CC=C(C)C)(C(=O)OC)C(=O)C(C(C)=O)C1(C)C |
| InChI | InChI=1S/C20H30O4/c1-8-9-15-12-20(18(23)24-7,11-10-13(2)3)17(22)16(14(4)21)19(15,5)6/h8,10,15-16H,1,9,11-12H2,2-7H3/t15-,16?,20+/m1/s1 |
| InChIKey | OXOZUUKWEMVMMY-YREILILBSA-N |
| XLogP | 3.90 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|