C19H26O7 — CID 155527004
methyl (3R,4aR,6S)-7-acetyl-3,6-dihydroxy-2,2-dimethyl-4a-(3-methylbut-2-enyl)-5-oxo-3,4-dihydrocyclopenta[b]pyran-6-carboxylate (PubChem CID 155527004) has the molecular formula C19H26O7 and a molecular weight of 366.41 g/mol. Its IUPAC name is methyl (3R,4aR,6S)-7-acetyl-3,6-dihydroxy-2,2-dimethyl-4a-(3-methylbut-2-enyl)-5-oxo-3,4-dihydrocyclopenta[b]pyran-6-carboxylate.
| Compound Name | methyl (3R,4aR,6S)-7-acetyl-3,6-dihydroxy-2,2-dimethyl-4a-(3-methylbut-2-enyl)-5-oxo-3,4-dihydrocyclopenta[b]pyran-6-carboxylate |
|---|---|
| PubChem CID | 155527004 |
| Molecular Formula | C19H26O7 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | methyl (3R,4aR,6S)-7-acetyl-3,6-dihydroxy-2,2-dimethyl-4a-(3-methylbut-2-enyl)-5-oxo-3,4-dihydrocyclopenta[b]pyran-6-carboxylate |
| SMILES | COC(=O)[C@@]1(O)C(=O)[C@]2(CC=C(C)C)C[C@@H](O)C(C)(C)OC2=C1C(C)=O |
| InChI | InChI=1S/C19H26O7/c1-10(2)7-8-18-9-12(21)17(4,5)26-14(18)13(11(3)20)19(24,15(18)22)16(23)25-6/h7,12,21,24H,8-9H2,1-6H3/t12-,18-,19+/m1/s1 |
| InChIKey | ZQRQLDLOXZSDNY-DPMMWBKBSA-N |
| XLogP | 1.22 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|