C30H44O5 — CID 132965802
(1R,3S,5R,7S)-4,4-dimethyl-1,3,7-tris(3-methylbut-2-enyl)-5-(2-methylpropanoyl)-8-oxabicyclo[5.2.1]decane-6,9,10-trione (PubChem CID 132965802) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is (1R,3S,5R,7S)-4,4-dimethyl-1,3,7-tris(3-methylbut-2-enyl)-5-(2-methylpropanoyl)-8-oxabicyclo[5.2.1]decane-6,9,10-trione.
| Compound Name | (1R,3S,5R,7S)-4,4-dimethyl-1,3,7-tris(3-methylbut-2-enyl)-5-(2-methylpropanoyl)-8-oxabicyclo[5.2.1]decane-6,9,10-trione |
|---|---|
| PubChem CID | 132965802 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (1R,3S,5R,7S)-4,4-dimethyl-1,3,7-tris(3-methylbut-2-enyl)-5-(2-methylpropanoyl)-8-oxabicyclo[5.2.1]decane-6,9,10-trione |
| SMILES | CC(C)=CC[C@H]1C[C@@]2(CC=C(C)C)C(=O)O[C@@](CC=C(C)C)(C(=O)[C@@H](C(=O)C(C)C)C1(C)C)C2=O |
| InChI | InChI=1S/C30H44O5/c1-18(2)11-12-22-17-29(15-13-19(3)4)26(33)30(35-27(29)34,16-14-20(5)6)25(32)23(28(22,9)10)24(31)21(7)8/h11,13-14,21-23H,12,15-17H2,1-10H3/t22-,23+,29+,30-/m0/s1 |
| InChIKey | XARVRLQCJNODAB-KWMMTJNNSA-N |
| XLogP | 6.36 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|