C12H18O5 — CID 141351469
methyl 2,3-dimethyl-4-oxo-7,9-dioxaspiro[4.5]decane-3-carboxylate (PubChem CID 141351469) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is methyl 2,3-dimethyl-4-oxo-7,9-dioxaspiro[4.5]decane-3-carboxylate.
| Compound Name | methyl 2,3-dimethyl-4-oxo-7,9-dioxaspiro[4.5]decane-3-carboxylate |
|---|---|
| PubChem CID | 141351469 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | methyl 2,3-dimethyl-4-oxo-7,9-dioxaspiro[4.5]decane-3-carboxylate |
| SMILES | COC(=O)C1(C)C(=O)C2(COCOC2)CC1C |
| InChI | InChI=1S/C12H18O5/c1-8-4-12(5-16-7-17-6-12)9(13)11(8,2)10(14)15-3/h8H,4-7H2,1-3H3 |
| InChIKey | RWVDZCXXYCUCJN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|