C10H19NO3 — CID 83908398
methyl 4-amino-3,3,5-trimethyloxane-4-carboxylate (PubChem CID 83908398) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is methyl 4-amino-3,3,5-trimethyloxane-4-carboxylate.
| Compound Name | methyl 4-amino-3,3,5-trimethyloxane-4-carboxylate |
|---|---|
| PubChem CID | 83908398 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | methyl 4-amino-3,3,5-trimethyloxane-4-carboxylate |
| SMILES | COC(=O)C1(N)C(C)COCC1(C)C |
| InChI | InChI=1S/C10H19NO3/c1-7-5-14-6-9(2,3)10(7,11)8(12)13-4/h7H,5-6,11H2,1-4H3 |
| InChIKey | JPNOZUKNXGDBMS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |