C8H12O4 — CID 165448019
methyl 4-methyl-1,6-dioxaspiro[2.4]heptane-2-carboxylate (PubChem CID 165448019) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is methyl 4-methyl-1,6-dioxaspiro[2.4]heptane-2-carboxylate.
| Compound Name | methyl 4-methyl-1,6-dioxaspiro[2.4]heptane-2-carboxylate |
|---|---|
| PubChem CID | 165448019 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | methyl 4-methyl-1,6-dioxaspiro[2.4]heptane-2-carboxylate |
| SMILES | COC(=O)C1OC12COCC2C |
| InChI | InChI=1S/C8H12O4/c1-5-3-11-4-8(5)6(12-8)7(9)10-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | UDILKQOMOKVWJC-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|