C9H15NO4 — CID 105453383
methyl 2,9-dioxa-6-azaspiro[4.5]decane-7-carboxylate (PubChem CID 105453383) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is methyl 2,9-dioxa-6-azaspiro[4.5]decane-7-carboxylate.
| Compound Name | methyl 2,9-dioxa-6-azaspiro[4.5]decane-7-carboxylate |
|---|---|
| PubChem CID | 105453383 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | methyl 2,9-dioxa-6-azaspiro[4.5]decane-7-carboxylate |
| SMILES | COC(=O)C1COCC2(CCOC2)N1 |
| InChI | InChI=1S/C9H15NO4/c1-12-8(11)7-4-14-6-9(10-7)2-3-13-5-9/h7,10H,2-6H2,1H3 |
| InChIKey | NJZWNVMZVBRTES-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |