C7H14N2O3 — CID 141446845
methyl (3S,5S)-5-(aminomethyl)morpholine-3-carboxylate (PubChem CID 141446845) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is methyl (3S,5S)-5-(aminomethyl)morpholine-3-carboxylate.
| Compound Name | methyl (3S,5S)-5-(aminomethyl)morpholine-3-carboxylate |
|---|---|
| PubChem CID | 141446845 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | methyl (3S,5S)-5-(aminomethyl)morpholine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1COC[C@H](CN)N1 |
| InChI | InChI=1S/C7H14N2O3/c1-11-7(10)6-4-12-3-5(2-8)9-6/h5-6,9H,2-4,8H2,1H3/t5-,6-/m0/s1 |
| InChIKey | JDHMVTKNQFZCMX-WDSKDSINSA-N |
| XLogP | -1.52 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |