About methyl 2-(aminomethyl)-4,5-dihydro-1H-imidazole-5-carboxylate
methyl 2-(aminomethyl)-4,5-dihydro-1H-imidazole-5-carboxylate (PubChem CID 105430638) has the molecular formula C6H11N3O2
and a molecular weight of 157.17 g/mol. Its IUPAC name is methyl 2-(aminomethyl)-4,5-dihydro-1H-imidazole-5-carboxylate.
Analyze methyl 2-(aminomethyl)-4,5-dihydro-1H-imidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(aminomethyl)-4,5-dihydro-1H-imidazole-5-carboxylate?
The IUPAC name of methyl 2-(aminomethyl)-4,5-dihydro-1H-imidazole-5-carboxylate (CID 105430638) is methyl 2-(aminomethyl)-4,5-dihydro-1H-imidazole-5-carboxylate.
What is the SMILES notation for methyl 2-(aminomethyl)-4,5-dihydro-1H-imidazole-5-carboxylate?
The canonical SMILES for methyl 2-(aminomethyl)-4,5-dihydro-1H-imidazole-5-carboxylate is COC(=O)C1CN=C(CN)N1.
What is the InChIKey of methyl 2-(aminomethyl)-4,5-dihydro-1H-imidazole-5-carboxylate?
The InChIKey is DPBPDDCMHXWZGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O2/c1-11-6(10)4-3-8-5(2-7)9-4/h4H,2-3,7H2,1H3,(H,8,9).
What are the key properties of methyl 2-(aminomethyl)-4,5-dihydro-1H-imidazole-5-carboxylate?
methyl 2-(aminomethyl)-4,5-dihydro-1H-imidazole-5-carboxylate has a molecular weight of 157.17 g/mol, XLogP of -1.51, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(aminomethyl)-4,5-dihydro-1H-imidazole-5-carboxylate is sourced from PubChem (CID 105430638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).