C8H13NO2S — CID 24975461
methyl 4,4-dimethyl-5-sulfanylidenepyrrolidine-2-carboxylate (PubChem CID 24975461) has the molecular formula C8H13NO2S and a molecular weight of 187.26 g/mol. Its IUPAC name is methyl 4,4-dimethyl-5-sulfanylidenepyrrolidine-2-carboxylate.
| Compound Name | methyl 4,4-dimethyl-5-sulfanylidenepyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 24975461 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | methyl 4,4-dimethyl-5-sulfanylidenepyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(C)(C)C(=S)N1 |
| InChI | InChI=1S/C8H13NO2S/c1-8(2)4-5(6(10)11-3)9-7(8)12/h5H,4H2,1-3H3,(H,9,12) |
| InChIKey | DURSSYZIMQTNQK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|