About methyl 4,4-dimethylpiperidine-2-carboxylate;hydrochloride
methyl 4,4-dimethylpiperidine-2-carboxylate;hydrochloride (PubChem CID 67791330) has the molecular formula C9H18ClNO2
and a molecular weight of 207.70 g/mol. Its IUPAC name is methyl 4,4-dimethylpiperidine-2-carboxylate;hydrochloride.
Analyze methyl 4,4-dimethylpiperidine-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4,4-dimethylpiperidine-2-carboxylate;hydrochloride?
The IUPAC name of methyl 4,4-dimethylpiperidine-2-carboxylate;hydrochloride (CID 67791330) is methyl 4,4-dimethylpiperidine-2-carboxylate;hydrochloride.
What is the SMILES notation for methyl 4,4-dimethylpiperidine-2-carboxylate;hydrochloride?
The canonical SMILES for methyl 4,4-dimethylpiperidine-2-carboxylate;hydrochloride is COC(=O)C1CC(C)(C)CCN1.Cl.
What is the InChIKey of methyl 4,4-dimethylpiperidine-2-carboxylate;hydrochloride?
The InChIKey is VZPUDYDFOJSSCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.ClH/c1-9(2)4-5-10-7(6-9)8(11)12-3;/h7,10H,4-6H2,1-3H3;1H.
What are the key properties of methyl 4,4-dimethylpiperidine-2-carboxylate;hydrochloride?
methyl 4,4-dimethylpiperidine-2-carboxylate;hydrochloride has a molecular weight of 207.70 g/mol, XLogP of 1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4,4-dimethylpiperidine-2-carboxylate;hydrochloride is sourced from PubChem (CID 67791330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).