methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate

C11H17NO4 — CID 165447869

IUPACmethyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate
SMILESCOC(=O)C1COC2(COC3(CCC3)C2)N1
InChIInChI=1S/C11H17NO4/c1-14-9(13)8-5-15-11(12-8)6-10(16-7-11)3-2-4-10/h8,12H,2-7H2,1H3
InChIKeyXBNOCDUSXROIIJ-UHFFFAOYSA-N
MW227.26 g/mol
LogP0.19
Rot. Bonds1

About methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate

methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate (PubChem CID 165447869) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate.

Molecular Properties

Compound Namemethyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate
PubChem CID165447869
Molecular FormulaC11H17NO4
Molecular Weight227.26 g/mol
Exact Mass227.12
IUPAC Namemethyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate
SMILESCOC(=O)C1COC2(COC3(CCC3)C2)N1
InChIInChI=1S/C11H17NO4/c1-14-9(13)8-5-15-11(12-8)6-10(16-7-11)3-2-4-10/h8,12H,2-7H2,1H3
InChIKeyXBNOCDUSXROIIJ-UHFFFAOYSA-N
XLogP0.19
TPSA56.79 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.26
LogP ≤ 50.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate?
The IUPAC name of methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate (CID 165447869) is methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate.
What is the SMILES notation for methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate?
The canonical SMILES for methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate is COC(=O)C1COC2(COC3(CCC3)C2)N1.
What is the InChIKey of methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate?
The InChIKey is XBNOCDUSXROIIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO4/c1-14-9(13)8-5-15-11(12-8)6-10(16-7-11)3-2-4-10/h8,12H,2-7H2,1H3.
What are the key properties of methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate?
methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate has a molecular weight of 227.26 g/mol, XLogP of 0.19, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate is sourced from PubChem (CID 165447869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).