About methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate
methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate (PubChem CID 165447869) has the molecular formula C11H17NO4
and a molecular weight of 227.26 g/mol. Its IUPAC name is methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate.
Analyze methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate?
The IUPAC name of methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate (CID 165447869) is methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate.
What is the SMILES notation for methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate?
The canonical SMILES for methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate is COC(=O)C1COC2(COC3(CCC3)C2)N1.
What is the InChIKey of methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate?
The InChIKey is XBNOCDUSXROIIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO4/c1-14-9(13)8-5-15-11(12-8)6-10(16-7-11)3-2-4-10/h8,12H,2-7H2,1H3.
What are the key properties of methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate?
methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate has a molecular weight of 227.26 g/mol, XLogP of 0.19, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 10,12-dioxa-7-azadispiro[3.1.46.24]dodecane-8-carboxylate is sourced from PubChem (CID 165447869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).