C7H13NO4 — CID 167726084
methyl (3S,4R)-4-amino-3-hydroxyoxane-4-carboxylate (PubChem CID 167726084) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is methyl (3S,4R)-4-amino-3-hydroxyoxane-4-carboxylate.
| Compound Name | methyl (3S,4R)-4-amino-3-hydroxyoxane-4-carboxylate |
|---|---|
| PubChem CID | 167726084 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | methyl (3S,4R)-4-amino-3-hydroxyoxane-4-carboxylate |
| SMILES | COC(=O)[C@@]1(N)CCOC[C@H]1O |
| InChI | InChI=1S/C7H13NO4/c1-11-6(10)7(8)2-3-12-4-5(7)9/h5,9H,2-4,8H2,1H3/t5-,7-/m1/s1 |
| InChIKey | FMCURUHZEOCTJH-IYSWYEEDSA-N |
| XLogP | -1.36 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |