About methyl 1-amino-3-hydroxy-4,4-dimethylcyclohexane-1-carboxylate
methyl 1-amino-3-hydroxy-4,4-dimethylcyclohexane-1-carboxylate (PubChem CID 165497125) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is methyl 1-amino-3-hydroxy-4,4-dimethylcyclohexane-1-carboxylate.
Analyze methyl 1-amino-3-hydroxy-4,4-dimethylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-amino-3-hydroxy-4,4-dimethylcyclohexane-1-carboxylate?
The IUPAC name of methyl 1-amino-3-hydroxy-4,4-dimethylcyclohexane-1-carboxylate (CID 165497125) is methyl 1-amino-3-hydroxy-4,4-dimethylcyclohexane-1-carboxylate.
What is the SMILES notation for methyl 1-amino-3-hydroxy-4,4-dimethylcyclohexane-1-carboxylate?
The canonical SMILES for methyl 1-amino-3-hydroxy-4,4-dimethylcyclohexane-1-carboxylate is COC(=O)C1(N)CCC(C)(C)C(O)C1.
What is the InChIKey of methyl 1-amino-3-hydroxy-4,4-dimethylcyclohexane-1-carboxylate?
The InChIKey is SQYSTZGUWOBACQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-9(2)4-5-10(11,6-7(9)12)8(13)14-3/h7,12H,4-6,11H2,1-3H3.
What are the key properties of methyl 1-amino-3-hydroxy-4,4-dimethylcyclohexane-1-carboxylate?
methyl 1-amino-3-hydroxy-4,4-dimethylcyclohexane-1-carboxylate has a molecular weight of 201.27 g/mol, XLogP of 0.43, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-amino-3-hydroxy-4,4-dimethylcyclohexane-1-carboxylate is sourced from PubChem (CID 165497125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).