C10H19NO2 — CID 176940576
methyl (1R)-1-amino-3-methylcycloheptane-1-carboxylate (PubChem CID 176940576) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is methyl (1R)-1-amino-3-methylcycloheptane-1-carboxylate.
| Compound Name | methyl (1R)-1-amino-3-methylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 176940576 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | methyl (1R)-1-amino-3-methylcycloheptane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(N)CCCCC(C)C1 |
| InChI | InChI=1S/C10H19NO2/c1-8-5-3-4-6-10(11,7-8)9(12)13-2/h8H,3-7,11H2,1-2H3/t8?,10-/m1/s1 |
| InChIKey | XLCSDUIIWSJUTN-LHIURRSHSA-N |
| XLogP | 1.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |