C8H16N2O — CID 93311266
cis-(1S,3S)-1-amino-3-methylcyclohexane-1-carboxamide (PubChem CID 93311266) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is cis-(1S,3S)-1-amino-3-methylcyclohexane-1-carboxamide.
| Compound Name | cis-(1S,3S)-1-amino-3-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 93311266 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | cis-(1S,3S)-1-amino-3-methylcyclohexane-1-carboxamide |
| SMILES | C[C@H]1CCC[C@@](N)(C(N)=O)C1 |
| InChI | InChI=1S/C8H16N2O/c1-6-3-2-4-8(10,5-6)7(9)11/h6H,2-5,10H2,1H3,(H2,9,11)/t6-,8-/m0/s1 |
| InChIKey | SDIIMRDPIGEJIP-XPUUQOCRSA-N |
| XLogP | 0.38 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |