C8H17ClNO4P — CID 134123358
(3-amino-3-methoxycarbonylcyclopentyl)-methylphosphinic acid;hydrochloride (PubChem CID 134123358) has the molecular formula C8H17ClNO4P and a molecular weight of 257.65 g/mol. Its IUPAC name is (3-amino-3-methoxycarbonylcyclopentyl)-methylphosphinic acid;hydrochloride.
| Compound Name | (3-amino-3-methoxycarbonylcyclopentyl)-methylphosphinic acid;hydrochloride |
|---|---|
| PubChem CID | 134123358 |
| Molecular Formula | C8H17ClNO4P |
| Molecular Weight | 257.65 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | (3-amino-3-methoxycarbonylcyclopentyl)-methylphosphinic acid;hydrochloride |
| SMILES | COC(=O)C1(N)CCC(P(C)(=O)O)C1.Cl |
| InChI | InChI=1S/C8H16NO4P.ClH/c1-13-7(10)8(9)4-3-6(5-8)14(2,11)12;/h6H,3-5,9H2,1-2H3,(H,11,12);1H |
| InChIKey | FMWPGVSUXZBPNF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.65 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|