C35H46O6 — CID 162938064
(1R,5R,6R,9S,11R)-1-benzoyl-5-ethoxy-6-hydroxy-4,4,12,12-tetramethyl-9,11-bis(3-methylbut-2-enyl)-3-oxatricyclo[7.3.1.02,7]tridec-2(7)-ene-8,13-dione (PubChem CID 162938064) has the molecular formula C35H46O6 and a molecular weight of 562.75 g/mol. Its IUPAC name is (1R,5R,6R,9S,11R)-1-benzoyl-5-ethoxy-6-hydroxy-4,4,12,12-tetramethyl-9,11-bis(3-methylbut-2-enyl)-3-oxatricyclo[7.3.1.02,7]tridec-2(7)-ene-8,13-dione.
| Compound Name | (1R,5R,6R,9S,11R)-1-benzoyl-5-ethoxy-6-hydroxy-4,4,12,12-tetramethyl-9,11-bis(3-methylbut-2-enyl)-3-oxatricyclo[7.3.1.02,7]tridec-2(7)-ene-8,13-dione |
|---|---|
| PubChem CID | 162938064 |
| Molecular Formula | C35H46O6 |
| Molecular Weight | 562.75 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | (1R,5R,6R,9S,11R)-1-benzoyl-5-ethoxy-6-hydroxy-4,4,12,12-tetramethyl-9,11-bis(3-methylbut-2-enyl)-3-oxatricyclo[7.3.1.02,7]tridec-2(7)-ene-8,13-dione |
| SMILES | CCO[C@@H]1[C@H](O)C2=C(OC1(C)C)[C@]1(C(=O)c3ccccc3)C(=O)[C@@](CC=C(C)C)(C[C@@H](CC=C(C)C)C1(C)C)C2=O |
| InChI | InChI=1S/C35H46O6/c1-10-40-30-26(36)25-28(38)34(19-18-22(4)5)20-24(17-16-21(2)3)32(6,7)35(31(34)39,29(25)41-33(30,8)9)27(37)23-14-12-11-13-15-23/h11-16,18,24,26,30,36H,10,17,19-20H2,1-9H3/t24-,26-,30-,34+,35-/m1/s1 |
| InChIKey | DFWYJVDNEJQKSY-RLVFDLNVSA-N |
| XLogP | 6.58 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.75 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|