C38H50O5 — CID 86765189
(3S)-8-benzoyl-3-[(2R)-2-hydroxy-6-methylhept-5-en-2-yl]-9,9-dimethyl-6,10-bis(3-methylbut-2-enyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione (PubChem CID 86765189) has the molecular formula C38H50O5 and a molecular weight of 586.81 g/mol. Its IUPAC name is (3S)-8-benzoyl-3-[(2R)-2-hydroxy-6-methylhept-5-en-2-yl]-9,9-dimethyl-6,10-bis(3-methylbut-2-enyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione.
| Compound Name | (3S)-8-benzoyl-3-[(2R)-2-hydroxy-6-methylhept-5-en-2-yl]-9,9-dimethyl-6,10-bis(3-methylbut-2-enyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione |
|---|---|
| PubChem CID | 86765189 |
| Molecular Formula | C38H50O5 |
| Molecular Weight | 586.81 g/mol |
| Exact Mass | 586.37 |
| IUPAC Name | (3S)-8-benzoyl-3-[(2R)-2-hydroxy-6-methylhept-5-en-2-yl]-9,9-dimethyl-6,10-bis(3-methylbut-2-enyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione |
| SMILES | CC(C)=CCC[C@@](C)(O)[C@@H]1CC23CC(CC=C(C)C)C(C)(C)C(C(=O)c4ccccc4)(C(=O)C(CC=C(C)C)=C2O1)C3=O |
| InChI | InChI=1S/C38H50O5/c1-24(2)14-13-21-36(9,42)30-23-37-22-28(19-17-25(3)4)35(7,8)38(34(37)41,31(39)27-15-11-10-12-16-27)32(40)29(33(37)43-30)20-18-26(5)6/h10-12,14-18,28,30,42H,13,19-23H2,1-9H3/t28?,30-,36+,37?,38?/m0/s1 |
| InChIKey | ORTSQUDXKWUIFJ-RCKVWBHUSA-N |
| XLogP | 8.29 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.81 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|