C33H42O6 — CID 163035213
(1R,3R,8S,10S)-8-benzoyl-10-(3-hydroxy-3-methylbut-1-enyl)-3-(2-hydroxypropan-2-yl)-9,9-dimethyl-6-(3-methylbut-2-enyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione (PubChem CID 163035213) has the molecular formula C33H42O6 and a molecular weight of 534.69 g/mol. Its IUPAC name is (1R,3R,8S,10S)-8-benzoyl-10-(3-hydroxy-3-methylbut-1-enyl)-3-(2-hydroxypropan-2-yl)-9,9-dimethyl-6-(3-methylbut-2-enyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione.
| Compound Name | (1R,3R,8S,10S)-8-benzoyl-10-(3-hydroxy-3-methylbut-1-enyl)-3-(2-hydroxypropan-2-yl)-9,9-dimethyl-6-(3-methylbut-2-enyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione |
|---|---|
| PubChem CID | 163035213 |
| Molecular Formula | C33H42O6 |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | (1R,3R,8S,10S)-8-benzoyl-10-(3-hydroxy-3-methylbut-1-enyl)-3-(2-hydroxypropan-2-yl)-9,9-dimethyl-6-(3-methylbut-2-enyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione |
| SMILES | CC(C)=CCC1=C2O[C@@H](C(C)(C)O)C[C@]23C[C@@H](C=CC(C)(C)O)C(C)(C)[C@](C(=O)c2ccccc2)(C1=O)C3=O |
| InChI | InChI=1S/C33H42O6/c1-20(2)14-15-23-26(35)33(25(34)21-12-10-9-11-13-21)28(36)32(19-24(31(7,8)38)39-27(23)32)18-22(30(33,5)6)16-17-29(3,4)37/h9-14,16-17,22,24,37-38H,15,18-19H2,1-8H3/t22-,24-,32-,33-/m1/s1 |
| InChIKey | MCORSAUVGAFHCE-POCMACRCSA-N |
| XLogP | 5.54 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|