C38H50O7 — CID 74412776
7-(3,4-dihydroxybenzoyl)-3-(3-hydroxy-3-methylbut-1-enyl)-4,4,10,10-tetramethyl-9,11-bis(3-methylbut-2-enyl)-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione (PubChem CID 74412776) has the molecular formula C38H50O7 and a molecular weight of 618.81 g/mol. Its IUPAC name is 7-(3,4-dihydroxybenzoyl)-3-(3-hydroxy-3-methylbut-1-enyl)-4,4,10,10-tetramethyl-9,11-bis(3-methylbut-2-enyl)-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione.
| Compound Name | 7-(3,4-dihydroxybenzoyl)-3-(3-hydroxy-3-methylbut-1-enyl)-4,4,10,10-tetramethyl-9,11-bis(3-methylbut-2-enyl)-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione |
|---|---|
| PubChem CID | 74412776 |
| Molecular Formula | C38H50O7 |
| Molecular Weight | 618.81 g/mol |
| Exact Mass | 618.36 |
| IUPAC Name | 7-(3,4-dihydroxybenzoyl)-3-(3-hydroxy-3-methylbut-1-enyl)-4,4,10,10-tetramethyl-9,11-bis(3-methylbut-2-enyl)-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione |
| SMILES | CC(C)=CCC1CC23CC(C=CC(C)(C)O)C(C)(C)OC2=C(C(=O)c2ccc(O)c(O)c2)C(=O)C(CC=C(C)C)(C3=O)C1(C)C |
| InChI | InChI=1S/C38H50O7/c1-22(2)11-13-25-20-37-21-26(16-17-34(5,6)44)36(9,10)45-32(37)29(30(41)24-12-14-27(39)28(40)19-24)31(42)38(33(37)43,35(25,7)8)18-15-23(3)4/h11-12,14-17,19,25-26,39-40,44H,13,18,20-21H2,1-10H3 |
| InChIKey | JLAFCMSSCDCWHQ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.81 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|