C66H84O8 — CID 162141523
1-benzoyl-4-hydroxy-8,8-dimethyl-3,5,7-tris(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 162141523) has the molecular formula C66H84O8 and a molecular weight of 1005.39 g/mol. Its IUPAC name is 1-benzoyl-4-hydroxy-8,8-dimethyl-3,5,7-tris(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | 1-benzoyl-4-hydroxy-8,8-dimethyl-3,5,7-tris(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 162141523 |
| Molecular Formula | C66H84O8 |
| Molecular Weight | 1005.39 g/mol |
| Exact Mass | 1004.62 |
| IUPAC Name | 1-benzoyl-4-hydroxy-8,8-dimethyl-3,5,7-tris(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | CC(C)=CCC1=C(O)C2(CC=C(C)C)CC(CC=C(C)C)C(C)(C)C(C(=O)c3ccccc3)(C1=O)C2=O.CC(C)=CCC1=C(O)C2(CC=C(C)C)CC(CC=C(C)C)C(C)(C)C(C(=O)c3ccccc3)(C1=O)C2=O |
| InChI | InChI=1S/2C33H42O4/c2*1-21(2)14-16-25-20-32(19-18-23(5)6)28(35)26(17-15-22(3)4)29(36)33(30(32)37,31(25,7)8)27(34)24-12-10-9-11-13-24/h2*9-15,18,25,35H,16-17,19-20H2,1-8H3 |
| InChIKey | FRCDNTHBWWQTER-UHFFFAOYSA-N |
| XLogP | 15.84 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.39 |
| LogP ≤ 5 | 15.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|