C31H48O5 — CID 163044486
(1S,5S,7R)-4-hydroxy-3-(3-hydroxy-3-methylbutyl)-8,8-dimethyl-1-[(2R)-2-methylbutanoyl]-5,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 163044486) has the molecular formula C31H48O5 and a molecular weight of 500.72 g/mol. Its IUPAC name is (1S,5S,7R)-4-hydroxy-3-(3-hydroxy-3-methylbutyl)-8,8-dimethyl-1-[(2R)-2-methylbutanoyl]-5,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (1S,5S,7R)-4-hydroxy-3-(3-hydroxy-3-methylbutyl)-8,8-dimethyl-1-[(2R)-2-methylbutanoyl]-5,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 163044486 |
| Molecular Formula | C31H48O5 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | (1S,5S,7R)-4-hydroxy-3-(3-hydroxy-3-methylbutyl)-8,8-dimethyl-1-[(2R)-2-methylbutanoyl]-5,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | CC[C@@H](C)C(=O)[C@]12C(=O)C(CCC(C)(C)O)=C(O)[C@](CC=C(C)C)(C[C@@H](CC=C(C)C)C1(C)C)C2=O |
| InChI | InChI=1S/C31H48O5/c1-11-21(6)24(32)31-26(34)23(15-16-28(7,8)36)25(33)30(27(31)35,17-14-20(4)5)18-22(29(31,9)10)13-12-19(2)3/h12,14,21-22,33,36H,11,13,15-18H2,1-10H3/t21-,22-,30+,31-/m1/s1 |
| InChIKey | VQVLNWYUSDHDBZ-CDFCBCNWSA-N |
| XLogP | 6.85 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|